C16H21NO — CID 130192705
(2E)-3,6-dimethyl-5-(4-methylanilino)hepta-2,6-dienal (PubChem CID 130192705) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is (2E)-3,6-dimethyl-5-(4-methylanilino)hepta-2,6-dienal.
| Compound Name | (2E)-3,6-dimethyl-5-(4-methylanilino)hepta-2,6-dienal |
|---|---|
| PubChem CID | 130192705 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (2E)-3,6-dimethyl-5-(4-methylanilino)hepta-2,6-dienal |
| SMILES | C=C(C)C(C/C(C)=C/C=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C16H21NO/c1-12(2)16(11-14(4)9-10-18)17-15-7-5-13(3)6-8-15/h5-10,16-17H,1,11H2,2-4H3/b14-9+ |
| InChIKey | KVCGADMUGCUCRK-NTEUORMPSA-N |
| XLogP | 3.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|