About 3-(3,4-dichlorophenyl)-5-(4-nitrophenyl)-2-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one
3-(3,4-dichlorophenyl)-5-(4-nitrophenyl)-2-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 130192819) has the molecular formula C24H14Cl2N4O3
and a molecular weight of 477.31 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-5-(4-nitrophenyl)-2-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 3-(3,4-dichlorophenyl)-5-(4-nitrophenyl)-2-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 130192819 |
| Molecular Formula | C24H14Cl2N4O3 |
| Molecular Weight | 477.31 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-5-(4-nitrophenyl)-2-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | O=c1cc(-c2ccc([N+](=O)[O-])cc2)nc2c(-c3ccc(Cl)c(Cl)c3)c(-c3ccccc3)[nH]n12 |
| InChI | InChI=1S/C24H14Cl2N4O3/c25-18-11-8-16(12-19(18)26)22-23(15-4-2-1-3-5-15)28-29-21(31)13-20(27-24(22)29)14-6-9-17(10-7-14)30(32)33/h1-13,28H |
| InChIKey | NWCUESFXBCLARE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.31 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dichlorophenyl)-5-(4-nitrophenyl)-2-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dichlorophenyl)-5-(4-nitrophenyl)-2-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 3-(3,4-dichlorophenyl)-5-(4-nitrophenyl)-2-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 130192819) is 3-(3,4-dichlorophenyl)-5-(4-nitrophenyl)-2-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 3-(3,4-dichlorophenyl)-5-(4-nitrophenyl)-2-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 3-(3,4-dichlorophenyl)-5-(4-nitrophenyl)-2-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one is O=c1cc(-c2ccc([N+](=O)[O-])cc2)nc2c(-c3ccc(Cl)c(Cl)c3)c(-c3ccccc3)[nH]n12.
What is the InChIKey of 3-(3,4-dichlorophenyl)-5-(4-nitrophenyl)-2-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is NWCUESFXBCLARE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14Cl2N4O3/c25-18-11-8-16(12-19(18)26)22-23(15-4-2-1-3-5-15)28-29-21(31)13-20(27-24(22)29)14-6-9-17(10-7-14)30(32)33/h1-13,28H.
What are the key properties of 3-(3,4-dichlorophenyl)-5-(4-nitrophenyl)-2-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
3-(3,4-dichlorophenyl)-5-(4-nitrophenyl)-2-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 477.31 g/mol, XLogP of 6.24, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dichlorophenyl)-5-(4-nitrophenyl)-2-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 130192819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).