C27H35N3O8 — CID 130192837
2-[3-amino-2-[(4-methyl-2,5-dioxo-1-phenylpyrrolidin-3-yl)methyl]-3-oxopropyl]-4-methyl-5-[2-(2-methylprop-2-enoylamino)ethoxy]-5-oxopentanoic acid (PubChem CID 130192837) has the molecular formula C27H35N3O8 and a molecular weight of 529.59 g/mol. Its IUPAC name is 2-[3-amino-2-[(4-methyl-2,5-dioxo-1-phenylpyrrolidin-3-yl)methyl]-3-oxopropyl]-4-methyl-5-[2-(2-methylprop-2-enoylamino)ethoxy]-5-oxopentanoic acid.
| Compound Name | 2-[3-amino-2-[(4-methyl-2,5-dioxo-1-phenylpyrrolidin-3-yl)methyl]-3-oxopropyl]-4-methyl-5-[2-(2-methylprop-2-enoylamino)ethoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 130192837 |
| Molecular Formula | C27H35N3O8 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | 2-[3-amino-2-[(4-methyl-2,5-dioxo-1-phenylpyrrolidin-3-yl)methyl]-3-oxopropyl]-4-methyl-5-[2-(2-methylprop-2-enoylamino)ethoxy]-5-oxopentanoic acid |
| SMILES | C=C(C)C(=O)NCCOC(=O)C(C)CC(CC(CC1C(=O)N(c2ccccc2)C(=O)C1C)C(N)=O)C(=O)O |
| InChI | InChI=1S/C27H35N3O8/c1-15(2)23(32)29-10-11-38-27(37)16(3)12-19(26(35)36)13-18(22(28)31)14-21-17(4)24(33)30(25(21)34)20-8-6-5-7-9-20/h5-9,16-19,21H,1,10-14H2,2-4H3,(H2,28,31)(H,29,32)(H,35,36) |
| InChIKey | BNTIUOIXLLVKEP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 173.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|