C13H17N — CID 130193556
(4Z,6Z)-N-[(1Z)-buta-1,3-dienyl]-3-methylideneocta-4,6-dien-2-imine (PubChem CID 130193556) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is (4Z,6Z)-N-[(1Z)-buta-1,3-dienyl]-3-methylideneocta-4,6-dien-2-imine.
| Compound Name | (4Z,6Z)-N-[(1Z)-buta-1,3-dienyl]-3-methylideneocta-4,6-dien-2-imine |
|---|---|
| PubChem CID | 130193556 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (4Z,6Z)-N-[(1Z)-buta-1,3-dienyl]-3-methylideneocta-4,6-dien-2-imine |
| SMILES | C=C/C=C\N=C(/C)C(=C)/C=C/C=C\C |
| InChI | InChI=1S/C13H17N/c1-5-7-9-10-12(3)13(4)14-11-8-6-2/h5-11H,2-3H2,1,4H3/b7-5-,10-9-,11-8-,14-13+ |
| InChIKey | IAAQKMZOIRIMSM-BPZUNMMDSA-N |
| XLogP | 3.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|