About 3,4-dimethyl-1-azacyclohepta-2,4,6,7-tetraene
3,4-dimethyl-1-azacyclohepta-2,4,6,7-tetraene (PubChem CID 130193686) has the molecular formula C8H9N
and a molecular weight of 119.17 g/mol. Its IUPAC name is 3,4-dimethyl-1-azacyclohepta-2,4,6,7-tetraene.
Analyze 3,4-dimethyl-1-azacyclohepta-2,4,6,7-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-1-azacyclohepta-2,4,6,7-tetraene?
The IUPAC name of 3,4-dimethyl-1-azacyclohepta-2,4,6,7-tetraene (CID 130193686) is 3,4-dimethyl-1-azacyclohepta-2,4,6,7-tetraene.
What is the SMILES notation for 3,4-dimethyl-1-azacyclohepta-2,4,6,7-tetraene?
The canonical SMILES for 3,4-dimethyl-1-azacyclohepta-2,4,6,7-tetraene is CC1=CC=C=NC=C1C.
What is the InChIKey of 3,4-dimethyl-1-azacyclohepta-2,4,6,7-tetraene?
The InChIKey is XRWFUJMEYKFMPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N/c1-7-4-3-5-9-6-8(7)2/h3-4,6H,1-2H3.
What are the key properties of 3,4-dimethyl-1-azacyclohepta-2,4,6,7-tetraene?
3,4-dimethyl-1-azacyclohepta-2,4,6,7-tetraene has a molecular weight of 119.17 g/mol, XLogP of 2.08, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-1-azacyclohepta-2,4,6,7-tetraene is sourced from PubChem (CID 130193686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).