C25H27FN2O5 — CID 130193821
1-(1,3-benzodioxol-5-yl)-N-[2-tert-butyl-1-(2,2-dihydroxyethyl)-6-fluoroindol-5-yl]cyclopropane-1-carboxamide (PubChem CID 130193821) has the molecular formula C25H27FN2O5 and a molecular weight of 454.50 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-[2-tert-butyl-1-(2,2-dihydroxyethyl)-6-fluoroindol-5-yl]cyclopropane-1-carboxamide.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-[2-tert-butyl-1-(2,2-dihydroxyethyl)-6-fluoroindol-5-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 130193821 |
| Molecular Formula | C25H27FN2O5 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-[2-tert-butyl-1-(2,2-dihydroxyethyl)-6-fluoroindol-5-yl]cyclopropane-1-carboxamide |
| SMILES | CC(C)(C)c1cc2cc(NC(=O)C3(c4ccc5c(c4)OCO5)CC3)c(F)cc2n1CC(O)O |
| InChI | InChI=1S/C25H27FN2O5/c1-24(2,3)21-9-14-8-17(16(26)11-18(14)28(21)12-22(29)30)27-23(31)25(6-7-25)15-4-5-19-20(10-15)33-13-32-19/h4-5,8-11,22,29-30H,6-7,12-13H2,1-3H3,(H,27,31) |
| InChIKey | UGDHBXSHJFHVCJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|