C18H33N3O3S6 — CID 130194361
1,3,5-tris[3-(2-sulfanylethylsulfanyl)propyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 130194361) has the molecular formula C18H33N3O3S6 and a molecular weight of 531.88 g/mol. Its IUPAC name is 1,3,5-tris[3-(2-sulfanylethylsulfanyl)propyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris[3-(2-sulfanylethylsulfanyl)propyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 130194361 |
| Molecular Formula | C18H33N3O3S6 |
| Molecular Weight | 531.88 g/mol |
| Exact Mass | 531.08 |
| IUPAC Name | 1,3,5-tris[3-(2-sulfanylethylsulfanyl)propyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1n(CCCSCCS)c(=O)n(CCCSCCS)c(=O)n1CCCSCCS |
| InChI | InChI=1S/C18H33N3O3S6/c22-16-19(4-1-10-28-13-7-25)17(23)21(6-3-12-30-15-9-27)18(24)20(16)5-2-11-29-14-8-26/h25-27H,1-15H2 |
| InChIKey | PCLQFUKMNVHDAE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.88 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|