C9H10F2 — CID 130195066
(1E,3E,6E)-1,3-difluoro-7-methylcycloocta-1,3,6-triene (PubChem CID 130195066) has the molecular formula C9H10F2 and a molecular weight of 156.18 g/mol. Its IUPAC name is (1E,3E,6E)-1,3-difluoro-7-methylcycloocta-1,3,6-triene.
| Compound Name | (1E,3E,6E)-1,3-difluoro-7-methylcycloocta-1,3,6-triene |
|---|---|
| PubChem CID | 130195066 |
| Molecular Formula | C9H10F2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (1E,3E,6E)-1,3-difluoro-7-methylcycloocta-1,3,6-triene |
| SMILES | C/C1=C/C/C=C(F)\C=C(\F)C1 |
| InChI | InChI=1S/C9H10F2/c1-7-3-2-4-8(10)6-9(11)5-7/h3-4,6H,2,5H2,1H3/b7-3-,8-4+,9-6+ |
| InChIKey | HCGYSPZGISVGMF-QKFDIOLESA-N |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|