About (Z)-8,9-dimethyl-4-methyliminodec-6-en-3-ol
(Z)-8,9-dimethyl-4-methyliminodec-6-en-3-ol (PubChem CID 130195067) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is (Z)-8,9-dimethyl-4-methyliminodec-6-en-3-ol.
Molecular Properties
| Compound Name | (Z)-8,9-dimethyl-4-methyliminodec-6-en-3-ol |
| PubChem CID | 130195067 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (Z)-8,9-dimethyl-4-methyliminodec-6-en-3-ol |
| SMILES | CCC(O)/C(C/C=C\C(C)C(C)C)=N/C |
| InChI | InChI=1S/C13H25NO/c1-6-13(15)12(14-5)9-7-8-11(4)10(2)3/h7-8,10-11,13,15H,6,9H2,1-5H3/b8-7-,14-12+ |
| InChIKey | GKCJWXRRCVRNIH-SXOVAMJMSA-N |
| XLogP | 3.07 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-8,9-dimethyl-4-methyliminodec-6-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-8,9-dimethyl-4-methyliminodec-6-en-3-ol?
The IUPAC name of (Z)-8,9-dimethyl-4-methyliminodec-6-en-3-ol (CID 130195067) is (Z)-8,9-dimethyl-4-methyliminodec-6-en-3-ol.
What is the SMILES notation for (Z)-8,9-dimethyl-4-methyliminodec-6-en-3-ol?
The canonical SMILES for (Z)-8,9-dimethyl-4-methyliminodec-6-en-3-ol is CCC(O)/C(C/C=C\C(C)C(C)C)=N/C.
What is the InChIKey of (Z)-8,9-dimethyl-4-methyliminodec-6-en-3-ol?
The InChIKey is GKCJWXRRCVRNIH-SXOVAMJMSA-N. The full InChI is InChI=1S/C13H25NO/c1-6-13(15)12(14-5)9-7-8-11(4)10(2)3/h7-8,10-11,13,15H,6,9H2,1-5H3/b8-7-,14-12+.
What are the key properties of (Z)-8,9-dimethyl-4-methyliminodec-6-en-3-ol?
(Z)-8,9-dimethyl-4-methyliminodec-6-en-3-ol has a molecular weight of 211.35 g/mol, XLogP of 3.07, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-8,9-dimethyl-4-methyliminodec-6-en-3-ol is sourced from PubChem (CID 130195067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).