C11H17NS — CID 130195093
2-[(Z)-but-2-enyl]-3,6-dimethyl-4,7-dihydro-1,4-thiazepine (PubChem CID 130195093) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is 2-[(Z)-but-2-enyl]-3,6-dimethyl-4,7-dihydro-1,4-thiazepine.
| Compound Name | 2-[(Z)-but-2-enyl]-3,6-dimethyl-4,7-dihydro-1,4-thiazepine |
|---|---|
| PubChem CID | 130195093 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 2-[(Z)-but-2-enyl]-3,6-dimethyl-4,7-dihydro-1,4-thiazepine |
| SMILES | C/C=C\CC1=C(C)NC=C(C)CS1 |
| InChI | InChI=1S/C11H17NS/c1-4-5-6-11-10(3)12-7-9(2)8-13-11/h4-5,7,12H,6,8H2,1-3H3/b5-4- |
| InChIKey | OBJVWTALVSJTPG-PLNGDYQASA-N |
| XLogP | 3.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|