About N-[(E)-but-2-en-2-yl]-N'-ethyl-N-methyl-N'-[(E)-prop-1-enyl]ethane-1,2-diamine
N-[(E)-but-2-en-2-yl]-N'-ethyl-N-methyl-N'-[(E)-prop-1-enyl]ethane-1,2-diamine (PubChem CID 130195118) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is N-[(E)-but-2-en-2-yl]-N'-ethyl-N-methyl-N'-[(E)-prop-1-enyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-[(E)-but-2-en-2-yl]-N'-ethyl-N-methyl-N'-[(E)-prop-1-enyl]ethane-1,2-diamine |
| PubChem CID | 130195118 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N-[(E)-but-2-en-2-yl]-N'-ethyl-N-methyl-N'-[(E)-prop-1-enyl]ethane-1,2-diamine |
| SMILES | C/C=C/N(CC)CCN(C)/C(C)=C/C |
| InChI | InChI=1S/C12H24N2/c1-6-9-14(8-3)11-10-13(5)12(4)7-2/h6-7,9H,8,10-11H2,1-5H3/b9-6+,12-7+ |
| InChIKey | NKQBNMVIRZVUGR-QBXHZEQXSA-N |
| XLogP | 2.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(E)-but-2-en-2-yl]-N'-ethyl-N-methyl-N'-[(E)-prop-1-enyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-but-2-en-2-yl]-N'-ethyl-N-methyl-N'-[(E)-prop-1-enyl]ethane-1,2-diamine?
The IUPAC name of N-[(E)-but-2-en-2-yl]-N'-ethyl-N-methyl-N'-[(E)-prop-1-enyl]ethane-1,2-diamine (CID 130195118) is N-[(E)-but-2-en-2-yl]-N'-ethyl-N-methyl-N'-[(E)-prop-1-enyl]ethane-1,2-diamine.
What is the SMILES notation for N-[(E)-but-2-en-2-yl]-N'-ethyl-N-methyl-N'-[(E)-prop-1-enyl]ethane-1,2-diamine?
The canonical SMILES for N-[(E)-but-2-en-2-yl]-N'-ethyl-N-methyl-N'-[(E)-prop-1-enyl]ethane-1,2-diamine is C/C=C/N(CC)CCN(C)/C(C)=C/C.
What is the InChIKey of N-[(E)-but-2-en-2-yl]-N'-ethyl-N-methyl-N'-[(E)-prop-1-enyl]ethane-1,2-diamine?
The InChIKey is NKQBNMVIRZVUGR-QBXHZEQXSA-N. The full InChI is InChI=1S/C12H24N2/c1-6-9-14(8-3)11-10-13(5)12(4)7-2/h6-7,9H,8,10-11H2,1-5H3/b9-6+,12-7+.
What are the key properties of N-[(E)-but-2-en-2-yl]-N'-ethyl-N-methyl-N'-[(E)-prop-1-enyl]ethane-1,2-diamine?
N-[(E)-but-2-en-2-yl]-N'-ethyl-N-methyl-N'-[(E)-prop-1-enyl]ethane-1,2-diamine has a molecular weight of 196.34 g/mol, XLogP of 2.70, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-but-2-en-2-yl]-N'-ethyl-N-methyl-N'-[(E)-prop-1-enyl]ethane-1,2-diamine is sourced from PubChem (CID 130195118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).