C12H23NS — CID 130195811
(2E,4E)-N,3-dimethyl-4-methylsulfanyl-N-propylhexa-2,4-dien-2-amine (PubChem CID 130195811) has the molecular formula C12H23NS and a molecular weight of 213.39 g/mol. Its IUPAC name is (2E,4E)-N,3-dimethyl-4-methylsulfanyl-N-propylhexa-2,4-dien-2-amine.
| Compound Name | (2E,4E)-N,3-dimethyl-4-methylsulfanyl-N-propylhexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 130195811 |
| Molecular Formula | C12H23NS |
| Molecular Weight | 213.39 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | (2E,4E)-N,3-dimethyl-4-methylsulfanyl-N-propylhexa-2,4-dien-2-amine |
| SMILES | C/C=C(SC)\C(C)=C(/C)N(C)CCC |
| InChI | InChI=1S/C12H23NS/c1-7-9-13(5)11(4)10(3)12(8-2)14-6/h8H,7,9H2,1-6H3/b11-10+,12-8+ |
| InChIKey | HSEDHRBJGUYIDP-HKCCEGKBSA-N |
| XLogP | 3.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|