C17H29NO10 — CID 130195858
[(2S,3R)-2-acetamido-3-[(3S)-1,3-diacetyloxybutan-2-yl]oxy-3-(2-hydroxyethoxy)propyl] acetate (PubChem CID 130195858) has the molecular formula C17H29NO10 and a molecular weight of 407.42 g/mol. Its IUPAC name is [(2S,3R)-2-acetamido-3-[(3S)-1,3-diacetyloxybutan-2-yl]oxy-3-(2-hydroxyethoxy)propyl] acetate.
| Compound Name | [(2S,3R)-2-acetamido-3-[(3S)-1,3-diacetyloxybutan-2-yl]oxy-3-(2-hydroxyethoxy)propyl] acetate |
|---|---|
| PubChem CID | 130195858 |
| Molecular Formula | C17H29NO10 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | [(2S,3R)-2-acetamido-3-[(3S)-1,3-diacetyloxybutan-2-yl]oxy-3-(2-hydroxyethoxy)propyl] acetate |
| SMILES | CC(=O)N[C@@H](COC(C)=O)[C@H](OCCO)OC(COC(C)=O)[C@H](C)OC(C)=O |
| InChI | InChI=1S/C17H29NO10/c1-10(27-14(5)23)16(9-26-13(4)22)28-17(24-7-6-19)15(18-11(2)20)8-25-12(3)21/h10,15-17,19H,6-9H2,1-5H3,(H,18,20)/t10-,15-,16?,17+/m0/s1 |
| InChIKey | ZSYQFBAJUXYBOI-BTVMRYLGSA-N |
| XLogP | -0.71 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|