C26H27NO6 — CID 130195980
(3R)-N-acetyl-2,3,4-trihydroxy-5-trityloxypentanamide (PubChem CID 130195980) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is (3R)-N-acetyl-2,3,4-trihydroxy-5-trityloxypentanamide.
| Compound Name | (3R)-N-acetyl-2,3,4-trihydroxy-5-trityloxypentanamide |
|---|---|
| PubChem CID | 130195980 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | (3R)-N-acetyl-2,3,4-trihydroxy-5-trityloxypentanamide |
| SMILES | CC(=O)NC(=O)C(O)[C@H](O)C(O)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H27NO6/c1-18(28)27-25(32)24(31)23(30)22(29)17-33-26(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,22-24,29-31H,17H2,1H3,(H,27,28,32)/t22?,23-,24?/m1/s1 |
| InChIKey | SMERNGYBODPJQO-NSQNTRMNSA-N |
| XLogP | 1.74 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|