About (2E)-N,2-dimethylpenta-2,4-dien-1-imine
(2E)-N,2-dimethylpenta-2,4-dien-1-imine (PubChem CID 130196080) has the molecular formula C7H11N
and a molecular weight of 109.17 g/mol. Its IUPAC name is (2E)-N,2-dimethylpenta-2,4-dien-1-imine.
Molecular Properties
| Compound Name | (2E)-N,2-dimethylpenta-2,4-dien-1-imine |
| PubChem CID | 130196080 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | (2E)-N,2-dimethylpenta-2,4-dien-1-imine |
| SMILES | C=C/C=C(C)/C=N/C |
| InChI | InChI=1S/C7H11N/c1-4-5-7(2)6-8-3/h4-6H,1H2,2-3H3/b7-5+,8-6+ |
| InChIKey | IPZRXXJQWFNBRM-KQQUZDAGSA-N |
| XLogP | 1.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N,2-dimethylpenta-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N,2-dimethylpenta-2,4-dien-1-imine?
The IUPAC name of (2E)-N,2-dimethylpenta-2,4-dien-1-imine (CID 130196080) is (2E)-N,2-dimethylpenta-2,4-dien-1-imine.
What is the SMILES notation for (2E)-N,2-dimethylpenta-2,4-dien-1-imine?
The canonical SMILES for (2E)-N,2-dimethylpenta-2,4-dien-1-imine is C=C/C=C(C)/C=N/C.
What is the InChIKey of (2E)-N,2-dimethylpenta-2,4-dien-1-imine?
The InChIKey is IPZRXXJQWFNBRM-KQQUZDAGSA-N. The full InChI is InChI=1S/C7H11N/c1-4-5-7(2)6-8-3/h4-6H,1H2,2-3H3/b7-5+,8-6+.
What are the key properties of (2E)-N,2-dimethylpenta-2,4-dien-1-imine?
(2E)-N,2-dimethylpenta-2,4-dien-1-imine has a molecular weight of 109.17 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N,2-dimethylpenta-2,4-dien-1-imine is sourced from PubChem (CID 130196080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).