C15H19F2O7P — CID 130196188
(2R,4S,5S)-2-[[(4S)-4-(3,5-difluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-5-methyloxolane-3,4-diol (PubChem CID 130196188) has the molecular formula C15H19F2O7P and a molecular weight of 380.28 g/mol. Its IUPAC name is (2R,4S,5S)-2-[[(4S)-4-(3,5-difluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-5-methyloxolane-3,4-diol.
| Compound Name | (2R,4S,5S)-2-[[(4S)-4-(3,5-difluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 130196188 |
| Molecular Formula | C15H19F2O7P |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | (2R,4S,5S)-2-[[(4S)-4-(3,5-difluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-5-methyloxolane-3,4-diol |
| SMILES | C[C@@H]1O[C@H](COP2(=O)OCC[C@@H](c3cc(F)cc(F)c3)O2)C(O)[C@@H]1O |
| InChI | InChI=1S/C15H19F2O7P/c1-8-14(18)15(19)13(23-8)7-22-25(20)21-3-2-12(24-25)9-4-10(16)6-11(17)5-9/h4-6,8,12-15,18-19H,2-3,7H2,1H3/t8-,12-,13+,14+,15?,25?/m0/s1 |
| InChIKey | KIBNLJOUYMQHOB-WODDNNCISA-N |
| XLogP | 2.08 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|