About 2-methylbutan-2-yl 5-ethenyl-2,2-dimethyl-1,3-dioxane-5-carboxylate
2-methylbutan-2-yl 5-ethenyl-2,2-dimethyl-1,3-dioxane-5-carboxylate (PubChem CID 130196281) has the molecular formula C14H24O4
and a molecular weight of 256.34 g/mol. Its IUPAC name is 2-methylbutan-2-yl 5-ethenyl-2,2-dimethyl-1,3-dioxane-5-carboxylate.
Molecular Properties
| Compound Name | 2-methylbutan-2-yl 5-ethenyl-2,2-dimethyl-1,3-dioxane-5-carboxylate |
| PubChem CID | 130196281 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2-methylbutan-2-yl 5-ethenyl-2,2-dimethyl-1,3-dioxane-5-carboxylate |
| SMILES | C=CC1(C(=O)OC(C)(C)CC)COC(C)(C)OC1 |
| InChI | InChI=1S/C14H24O4/c1-7-12(3,4)18-11(15)14(8-2)9-16-13(5,6)17-10-14/h8H,2,7,9-10H2,1,3-6H3 |
| InChIKey | DPBRGNSYBNVOMS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutan-2-yl 5-ethenyl-2,2-dimethyl-1,3-dioxane-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutan-2-yl 5-ethenyl-2,2-dimethyl-1,3-dioxane-5-carboxylate?
The IUPAC name of 2-methylbutan-2-yl 5-ethenyl-2,2-dimethyl-1,3-dioxane-5-carboxylate (CID 130196281) is 2-methylbutan-2-yl 5-ethenyl-2,2-dimethyl-1,3-dioxane-5-carboxylate.
What is the SMILES notation for 2-methylbutan-2-yl 5-ethenyl-2,2-dimethyl-1,3-dioxane-5-carboxylate?
The canonical SMILES for 2-methylbutan-2-yl 5-ethenyl-2,2-dimethyl-1,3-dioxane-5-carboxylate is C=CC1(C(=O)OC(C)(C)CC)COC(C)(C)OC1.
What is the InChIKey of 2-methylbutan-2-yl 5-ethenyl-2,2-dimethyl-1,3-dioxane-5-carboxylate?
The InChIKey is DPBRGNSYBNVOMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O4/c1-7-12(3,4)18-11(15)14(8-2)9-16-13(5,6)17-10-14/h8H,2,7,9-10H2,1,3-6H3.
What are the key properties of 2-methylbutan-2-yl 5-ethenyl-2,2-dimethyl-1,3-dioxane-5-carboxylate?
2-methylbutan-2-yl 5-ethenyl-2,2-dimethyl-1,3-dioxane-5-carboxylate has a molecular weight of 256.34 g/mol, XLogP of 2.67, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutan-2-yl 5-ethenyl-2,2-dimethyl-1,3-dioxane-5-carboxylate is sourced from PubChem (CID 130196281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).