C12H19Br2N — CID 130196804
2,7-dibromo-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-carbazole (PubChem CID 130196804) has the molecular formula C12H19Br2N and a molecular weight of 337.10 g/mol. Its IUPAC name is 2,7-dibromo-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-carbazole.
| Compound Name | 2,7-dibromo-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-carbazole |
|---|---|
| PubChem CID | 130196804 |
| Molecular Formula | C12H19Br2N |
| Molecular Weight | 337.10 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 2,7-dibromo-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-carbazole |
| SMILES | BrC1CCC2C(C1)NC1CC(Br)CCC12 |
| InChI | InChI=1S/C12H19Br2N/c13-7-1-3-9-10-4-2-8(14)6-12(10)15-11(9)5-7/h7-12,15H,1-6H2 |
| InChIKey | YZQWYGFKXHPVIX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.10 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|