C33H48O6S — CID 130196888
methyl (3R)-3-[(3R,5S,6R,10S,13R,17R)-6-ethyl-10,13-dimethyl-3-(4-methylphenyl)sulfonyloxy-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoate (PubChem CID 130196888) has the molecular formula C33H48O6S and a molecular weight of 572.81 g/mol. Its IUPAC name is methyl (3R)-3-[(3R,5S,6R,10S,13R,17R)-6-ethyl-10,13-dimethyl-3-(4-methylphenyl)sulfonyloxy-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoate.
| Compound Name | methyl (3R)-3-[(3R,5S,6R,10S,13R,17R)-6-ethyl-10,13-dimethyl-3-(4-methylphenyl)sulfonyloxy-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoate |
|---|---|
| PubChem CID | 130196888 |
| Molecular Formula | C33H48O6S |
| Molecular Weight | 572.81 g/mol |
| Exact Mass | 572.32 |
| IUPAC Name | methyl (3R)-3-[(3R,5S,6R,10S,13R,17R)-6-ethyl-10,13-dimethyl-3-(4-methylphenyl)sulfonyloxy-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoate |
| SMILES | CC[C@H]1C(=O)C2C3CC[C@H]([C@H](C)CC(=O)OC)[C@@]3(C)CCC2[C@@]2(C)CC[C@@H](OS(=O)(=O)c3ccc(C)cc3)C[C@@H]12 |
| InChI | InChI=1S/C33H48O6S/c1-7-24-28-19-22(39-40(36,37)23-10-8-20(2)9-11-23)14-16-33(28,5)27-15-17-32(4)25(21(3)18-29(34)38-6)12-13-26(32)30(27)31(24)35/h8-11,21-22,24-28,30H,7,12-19H2,1-6H3/t21-,22-,24-,25-,26?,27?,28+,30?,32-,33-/m1/s1 |
| InChIKey | KGAYLSVRVQPCCK-UMPGZEOXSA-N |
| XLogP | 6.74 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.81 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|