C14H15ClN2O — CID 130196962
3-chloro-N,N-dimethyl-4-(pyridin-2-ylmethoxy)aniline (PubChem CID 130196962) has the molecular formula C14H15ClN2O and a molecular weight of 262.74 g/mol. Its IUPAC name is 3-chloro-N,N-dimethyl-4-(pyridin-2-ylmethoxy)aniline.
| Compound Name | 3-chloro-N,N-dimethyl-4-(pyridin-2-ylmethoxy)aniline |
|---|---|
| PubChem CID | 130196962 |
| Molecular Formula | C14H15ClN2O |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 3-chloro-N,N-dimethyl-4-(pyridin-2-ylmethoxy)aniline |
| SMILES | CN(C)c1ccc(OCc2ccccn2)c(Cl)c1 |
| InChI | InChI=1S/C14H15ClN2O/c1-17(2)12-6-7-14(13(15)9-12)18-10-11-5-3-4-8-16-11/h3-9H,10H2,1-2H3 |
| InChIKey | OKYUXQLLYCNZIU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|