About ethyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate
ethyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate (PubChem CID 130197139) has the molecular formula C17H11BrF6N2O2
and a molecular weight of 469.18 g/mol. Its IUPAC name is ethyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate |
| PubChem CID | 130197139 |
| Molecular Formula | C17H11BrF6N2O2 |
| Molecular Weight | 469.18 g/mol |
| Exact Mass | 467.99 |
| IUPAC Name | ethyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate |
| SMILES | CCOC(=O)/C(Br)=C\c1ccnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C17H11BrF6N2O2/c1-2-28-15(27)13(18)8-12-3-4-25-14(26-12)9-5-10(16(19,20)21)7-11(6-9)17(22,23)24/h3-8H,2H2,1H3/b13-8+ |
| InChIKey | RREHQLDHALXBOO-MDWZMJQESA-N |
| XLogP | 5.48 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.18 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate?
The IUPAC name of ethyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate (CID 130197139) is ethyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate.
What is the SMILES notation for ethyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate?
The canonical SMILES for ethyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate is CCOC(=O)/C(Br)=C\c1ccnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1.
What is the InChIKey of ethyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate?
The InChIKey is RREHQLDHALXBOO-MDWZMJQESA-N. The full InChI is InChI=1S/C17H11BrF6N2O2/c1-2-28-15(27)13(18)8-12-3-4-25-14(26-12)9-5-10(16(19,20)21)7-11(6-9)17(22,23)24/h3-8H,2H2,1H3/b13-8+.
What are the key properties of ethyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate?
ethyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate has a molecular weight of 469.18 g/mol, XLogP of 5.48, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate is sourced from PubChem (CID 130197139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).