C14H16FN — CID 130197563
(3E,5Z)-N-fluoro-N-[(3E)-hexa-1,3,5-trien-3-yl]octa-1,3,5,7-tetraen-4-amine (PubChem CID 130197563) has the molecular formula C14H16FN and a molecular weight of 217.29 g/mol. Its IUPAC name is (3E,5Z)-N-fluoro-N-[(3E)-hexa-1,3,5-trien-3-yl]octa-1,3,5,7-tetraen-4-amine.
| Compound Name | (3E,5Z)-N-fluoro-N-[(3E)-hexa-1,3,5-trien-3-yl]octa-1,3,5,7-tetraen-4-amine |
|---|---|
| PubChem CID | 130197563 |
| Molecular Formula | C14H16FN |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | (3E,5Z)-N-fluoro-N-[(3E)-hexa-1,3,5-trien-3-yl]octa-1,3,5,7-tetraen-4-amine |
| SMILES | C=C/C=C\C(=C/C=C)N(F)/C(C=C)=C/C=C |
| InChI | InChI=1S/C14H16FN/c1-5-9-12-14(11-7-3)16(15)13(8-4)10-6-2/h5-12H,1-4H2/b12-9-,13-10+,14-11+ |
| InChIKey | OGFPMFUGHJGDAF-IGHNMMEESA-N |
| XLogP | 4.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|