About (3S,6R)-6-methyloxan-3-amine
(3S,6R)-6-methyloxan-3-amine (PubChem CID 130197714) has the molecular formula C6H13NO
and a molecular weight of 115.18 g/mol. Its IUPAC name is (3S,6R)-6-methyloxan-3-amine.
Molecular Properties
| Compound Name | (3S,6R)-6-methyloxan-3-amine |
| PubChem CID | 130197714 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | (3S,6R)-6-methyloxan-3-amine |
| SMILES | C[C@@H]1CC[C@H](N)CO1 |
| InChI | InChI=1S/C6H13NO/c1-5-2-3-6(7)4-8-5/h5-6H,2-4,7H2,1H3/t5-,6+/m1/s1 |
| InChIKey | DAYKBIZRMJSWHJ-RITPCOANSA-N |
| XLogP | 0.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,6R)-6-methyloxan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,6R)-6-methyloxan-3-amine?
The IUPAC name of (3S,6R)-6-methyloxan-3-amine (CID 130197714) is (3S,6R)-6-methyloxan-3-amine.
What is the SMILES notation for (3S,6R)-6-methyloxan-3-amine?
The canonical SMILES for (3S,6R)-6-methyloxan-3-amine is C[C@@H]1CC[C@H](N)CO1.
What is the InChIKey of (3S,6R)-6-methyloxan-3-amine?
The InChIKey is DAYKBIZRMJSWHJ-RITPCOANSA-N. The full InChI is InChI=1S/C6H13NO/c1-5-2-3-6(7)4-8-5/h5-6H,2-4,7H2,1H3/t5-,6+/m1/s1.
What are the key properties of (3S,6R)-6-methyloxan-3-amine?
(3S,6R)-6-methyloxan-3-amine has a molecular weight of 115.18 g/mol, XLogP of 0.51, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,6R)-6-methyloxan-3-amine is sourced from PubChem (CID 130197714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).