C13H18O2 — CID 130198240
(1'S,9'R)-5'-ethylspiro[1,3-dioxolane-2,2'-tricyclo[4.2.1.03,9]non-4-ene] (PubChem CID 130198240) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (1'S,9'R)-5'-ethylspiro[1,3-dioxolane-2,2'-tricyclo[4.2.1.03,9]non-4-ene].
| Compound Name | (1'S,9'R)-5'-ethylspiro[1,3-dioxolane-2,2'-tricyclo[4.2.1.03,9]non-4-ene] |
|---|---|
| PubChem CID | 130198240 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (1'S,9'R)-5'-ethylspiro[1,3-dioxolane-2,2'-tricyclo[4.2.1.03,9]non-4-ene] |
| SMILES | CCC1=CC2[C@@H]3C1CC[C@@H]3C21OCCO1 |
| InChI | InChI=1S/C13H18O2/c1-2-8-7-11-12-9(8)3-4-10(12)13(11)14-5-6-15-13/h7,9-12H,2-6H2,1H3/t9?,10-,11?,12+/m0/s1 |
| InChIKey | CRZAKKKGOVOOHB-POSLAHMBSA-N |
| XLogP | 2.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|