C13H16O2 — CID 130198439
2-[(2S,3S,9R)-5-ethyl-2-tetracyclo[4.3.0.01,3.02,9]non-4-enyl]acetic acid (PubChem CID 130198439) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-[(2S,3S,9R)-5-ethyl-2-tetracyclo[4.3.0.01,3.02,9]non-4-enyl]acetic acid.
| Compound Name | 2-[(2S,3S,9R)-5-ethyl-2-tetracyclo[4.3.0.01,3.02,9]non-4-enyl]acetic acid |
|---|---|
| PubChem CID | 130198439 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 2-[(2S,3S,9R)-5-ethyl-2-tetracyclo[4.3.0.01,3.02,9]non-4-enyl]acetic acid |
| SMILES | CCC1=C[C@@H]2C34C1CC[C@@H]3[C@@]24CC(=O)O |
| InChI | InChI=1S/C13H16O2/c1-2-7-5-10-12(6-11(14)15)9-4-3-8(7)13(9,10)12/h5,8-10H,2-4,6H2,1H3,(H,14,15)/t8?,9-,10+,12+,13?/m1/s1 |
| InChIKey | FMOAOOCNSKCLTA-NYOPSTAGSA-N |
| XLogP | 2.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|