C15H29N3 — CID 130199244
N-(4-butan-2-ylcyclohexa-1,3-dien-1-yl)-N',N',N",N"-tetramethylmethanetriamine (PubChem CID 130199244) has the molecular formula C15H29N3 and a molecular weight of 251.42 g/mol. Its IUPAC name is N-(4-butan-2-ylcyclohexa-1,3-dien-1-yl)-N',N',N",N"-tetramethylmethanetriamine.
| Compound Name | N-(4-butan-2-ylcyclohexa-1,3-dien-1-yl)-N',N',N",N"-tetramethylmethanetriamine |
|---|---|
| PubChem CID | 130199244 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | N-(4-butan-2-ylcyclohexa-1,3-dien-1-yl)-N',N',N",N"-tetramethylmethanetriamine |
| SMILES | CCC(C)C1=CC=C(NC(N(C)C)N(C)C)CC1 |
| InChI | InChI=1S/C15H29N3/c1-7-12(2)13-8-10-14(11-9-13)16-15(17(3)4)18(5)6/h8,10,12,15-16H,7,9,11H2,1-6H3 |
| InChIKey | RYVXTURLOUYVLT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|