C12H17NO2 — CID 130199481
2-(3-oxobut-1-en-2-yl)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one (PubChem CID 130199481) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-(3-oxobut-1-en-2-yl)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one.
| Compound Name | 2-(3-oxobut-1-en-2-yl)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one |
|---|---|
| PubChem CID | 130199481 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-(3-oxobut-1-en-2-yl)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one |
| SMILES | C=C(C(C)=O)C1CC2CC(=O)CCN2C1 |
| InChI | InChI=1S/C12H17NO2/c1-8(9(2)14)10-5-11-6-12(15)3-4-13(11)7-10/h10-11H,1,3-7H2,2H3 |
| InChIKey | NYILIPLMEHGXJP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|