C10H8N4O5 — CID 130200223
2,4,6-trioxo-N-(6-oxo-1H-pyridin-3-yl)-1,3-diazinane-5-carboxamide (PubChem CID 130200223) has the molecular formula C10H8N4O5 and a molecular weight of 264.20 g/mol. Its IUPAC name is 2,4,6-trioxo-N-(6-oxo-1H-pyridin-3-yl)-1,3-diazinane-5-carboxamide.
| Compound Name | 2,4,6-trioxo-N-(6-oxo-1H-pyridin-3-yl)-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 130200223 |
| Molecular Formula | C10H8N4O5 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 2,4,6-trioxo-N-(6-oxo-1H-pyridin-3-yl)-1,3-diazinane-5-carboxamide |
| SMILES | O=C1NC(=O)C(C(=O)Nc2ccc(=O)[nH]c2)C(=O)N1 |
| InChI | InChI=1S/C10H8N4O5/c15-5-2-1-4(3-11-5)12-7(16)6-8(17)13-10(19)14-9(6)18/h1-3,6H,(H,11,15)(H,12,16)(H2,13,14,17,18,19) |
| InChIKey | MBMYBXAQLGQCJE-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|