About 3-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-4-fluoro-N-methylbenzamide
3-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-4-fluoro-N-methylbenzamide (PubChem CID 130200282) has the molecular formula C21H17F2N5O
and a molecular weight of 393.40 g/mol. Its IUPAC name is 3-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-4-fluoro-N-methylbenzamide.
Molecular Properties
| Compound Name | 3-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-4-fluoro-N-methylbenzamide |
| PubChem CID | 130200282 |
| Molecular Formula | C21H17F2N5O |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 3-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-4-fluoro-N-methylbenzamide |
| SMILES | CCn1cnc2c(-c3ccc(F)c(-c4cc(C(=O)NC)ccc4F)c3)cnnc21 |
| InChI | InChI=1S/C21H17F2N5O/c1-3-28-11-25-19-16(10-26-27-20(19)28)12-4-6-17(22)14(8-12)15-9-13(21(29)24-2)5-7-18(15)23/h4-11H,3H2,1-2H3,(H,24,29) |
| InChIKey | XCXBURJIIGROEA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-4-fluoro-N-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-4-fluoro-N-methylbenzamide?
The IUPAC name of 3-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-4-fluoro-N-methylbenzamide (CID 130200282) is 3-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-4-fluoro-N-methylbenzamide.
What is the SMILES notation for 3-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-4-fluoro-N-methylbenzamide?
The canonical SMILES for 3-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-4-fluoro-N-methylbenzamide is CCn1cnc2c(-c3ccc(F)c(-c4cc(C(=O)NC)ccc4F)c3)cnnc21.
What is the InChIKey of 3-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-4-fluoro-N-methylbenzamide?
The InChIKey is XCXBURJIIGROEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17F2N5O/c1-3-28-11-25-19-16(10-26-27-20(19)28)12-4-6-17(22)14(8-12)15-9-13(21(29)24-2)5-7-18(15)23/h4-11H,3H2,1-2H3,(H,24,29).
What are the key properties of 3-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-4-fluoro-N-methylbenzamide?
3-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-4-fluoro-N-methylbenzamide has a molecular weight of 393.40 g/mol, XLogP of 3.82, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-4-fluoro-N-methylbenzamide is sourced from PubChem (CID 130200282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).