About 6-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-2-methyl-3H-isoindol-1-one
6-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-2-methyl-3H-isoindol-1-one (PubChem CID 130200307) has the molecular formula C22H18FN5O
and a molecular weight of 387.42 g/mol. Its IUPAC name is 6-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-2-methyl-3H-isoindol-1-one.
Molecular Properties
| Compound Name | 6-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-2-methyl-3H-isoindol-1-one |
| PubChem CID | 130200307 |
| Molecular Formula | C22H18FN5O |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 6-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-2-methyl-3H-isoindol-1-one |
| SMILES | CCn1cnc2c(-c3ccc(F)c(-c4ccc5c(c4)C(=O)N(C)C5)c3)cnnc21 |
| InChI | InChI=1S/C22H18FN5O/c1-3-28-12-24-20-18(10-25-26-21(20)28)14-6-7-19(23)16(8-14)13-4-5-15-11-27(2)22(29)17(15)9-13/h4-10,12H,3,11H2,1-2H3 |
| InChIKey | CHIRBXJNJJPPBZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-2-methyl-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-2-methyl-3H-isoindol-1-one?
The IUPAC name of 6-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-2-methyl-3H-isoindol-1-one (CID 130200307) is 6-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-2-methyl-3H-isoindol-1-one.
What is the SMILES notation for 6-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-2-methyl-3H-isoindol-1-one?
The canonical SMILES for 6-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-2-methyl-3H-isoindol-1-one is CCn1cnc2c(-c3ccc(F)c(-c4ccc5c(c4)C(=O)N(C)C5)c3)cnnc21.
What is the InChIKey of 6-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-2-methyl-3H-isoindol-1-one?
The InChIKey is CHIRBXJNJJPPBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18FN5O/c1-3-28-12-24-20-18(10-25-26-21(20)28)14-6-7-19(23)16(8-14)13-4-5-15-11-27(2)22(29)17(15)9-13/h4-10,12H,3,11H2,1-2H3.
What are the key properties of 6-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-2-methyl-3H-isoindol-1-one?
6-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-2-methyl-3H-isoindol-1-one has a molecular weight of 387.42 g/mol, XLogP of 3.90, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[5-(7-ethylimidazo[4,5-c]pyridazin-4-yl)-2-fluorophenyl]-2-methyl-3H-isoindol-1-one is sourced from PubChem (CID 130200307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).