C21H19N3O2S — CID 130200311
12-cyclobutyl-2,5-dimethyl-11-phenyl-6-thia-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7),4,12-tetraene-8,10-dione (PubChem CID 130200311) has the molecular formula C21H19N3O2S and a molecular weight of 377.47 g/mol. Its IUPAC name is 12-cyclobutyl-2,5-dimethyl-11-phenyl-6-thia-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7),4,12-tetraene-8,10-dione.
| Compound Name | 12-cyclobutyl-2,5-dimethyl-11-phenyl-6-thia-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7),4,12-tetraene-8,10-dione |
|---|---|
| PubChem CID | 130200311 |
| Molecular Formula | C21H19N3O2S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 12-cyclobutyl-2,5-dimethyl-11-phenyl-6-thia-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7),4,12-tetraene-8,10-dione |
| SMILES | Cc1cc2c(s1)c(=O)c1c(=O)n(-c3ccccc3)c(C3CCC3)nc1n2C |
| InChI | InChI=1S/C21H19N3O2S/c1-12-11-15-18(27-12)17(25)16-20(23(15)2)22-19(13-7-6-8-13)24(21(16)26)14-9-4-3-5-10-14/h3-5,9-11,13H,6-8H2,1-2H3 |
| InChIKey | IOWPFPFNTQWQBY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |