C26H26F3N5O — CID 130201269
8-(dimethylamino)-8-phenyl-3-[2-(3,4,5-trifluorophenyl)pyrimidin-5-yl]-1,3-diazaspiro[4.5]decan-2-one (PubChem CID 130201269) has the molecular formula C26H26F3N5O and a molecular weight of 481.52 g/mol. Its IUPAC name is 8-(dimethylamino)-8-phenyl-3-[2-(3,4,5-trifluorophenyl)pyrimidin-5-yl]-1,3-diazaspiro[4.5]decan-2-one.
| Compound Name | 8-(dimethylamino)-8-phenyl-3-[2-(3,4,5-trifluorophenyl)pyrimidin-5-yl]-1,3-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 130201269 |
| Molecular Formula | C26H26F3N5O |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 8-(dimethylamino)-8-phenyl-3-[2-(3,4,5-trifluorophenyl)pyrimidin-5-yl]-1,3-diazaspiro[4.5]decan-2-one |
| SMILES | CN(C)C1(c2ccccc2)CCC2(CC1)CN(c1cnc(-c3cc(F)c(F)c(F)c3)nc1)C(=O)N2 |
| InChI | InChI=1S/C26H26F3N5O/c1-33(2)26(18-6-4-3-5-7-18)10-8-25(9-11-26)16-34(24(35)32-25)19-14-30-23(31-15-19)17-12-20(27)22(29)21(28)13-17/h3-7,12-15H,8-11,16H2,1-2H3,(H,32,35) |
| InChIKey | CSSLVBHCLDECEY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|