C20H20ClN3O3 — CID 130201939
N-hydroxy-3-[4-[5-(4-methoxyphenyl)-3-methylimidazol-4-yl]phenyl]prop-2-enamide;hydrochloride (PubChem CID 130201939) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is N-hydroxy-3-[4-[5-(4-methoxyphenyl)-3-methylimidazol-4-yl]phenyl]prop-2-enamide;hydrochloride.
| Compound Name | N-hydroxy-3-[4-[5-(4-methoxyphenyl)-3-methylimidazol-4-yl]phenyl]prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 130201939 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-hydroxy-3-[4-[5-(4-methoxyphenyl)-3-methylimidazol-4-yl]phenyl]prop-2-enamide;hydrochloride |
| SMILES | COc1ccc(-c2ncn(C)c2-c2ccc(C=CC(=O)NO)cc2)cc1.Cl |
| InChI | InChI=1S/C20H19N3O3.ClH/c1-23-13-21-19(15-8-10-17(26-2)11-9-15)20(23)16-6-3-14(4-7-16)5-12-18(24)22-25;/h3-13,25H,1-2H3,(H,22,24);1H |
| InChIKey | UVWQQKROIKZLEP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|