C26H21FN2O3S — CID 130202325
(5Z)-5-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-2-[(4-fluorophenyl)methylimino]-3-(4-methylphenyl)-1,3-thiazolidin-4-one (PubChem CID 130202325) has the molecular formula C26H21FN2O3S and a molecular weight of 460.53 g/mol. Its IUPAC name is (5Z)-5-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-2-[(4-fluorophenyl)methylimino]-3-(4-methylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-2-[(4-fluorophenyl)methylimino]-3-(4-methylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 130202325 |
| Molecular Formula | C26H21FN2O3S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | (5Z)-5-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-2-[(4-fluorophenyl)methylimino]-3-(4-methylphenyl)-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(N2C(=O)/C(=C/c3ccc4c(c3)OCCO4)S/C2=N\Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H21FN2O3S/c1-17-2-9-21(10-3-17)29-25(30)24(15-19-6-11-22-23(14-19)32-13-12-31-22)33-26(29)28-16-18-4-7-20(27)8-5-18/h2-11,14-15H,12-13,16H2,1H3/b24-15-,28-26- |
| InChIKey | GNSGNEQUOVTITQ-AHHHDHMGSA-N |
| XLogP | 5.58 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|