C29H41N3O3 — CID 130202378
8-(dimethylamino)-1-(4-methoxybutyl)-3-[(4-methoxyphenyl)methyl]-8-phenyl-1,3-diazaspiro[4.5]decan-2-one (PubChem CID 130202378) has the molecular formula C29H41N3O3 and a molecular weight of 479.67 g/mol. Its IUPAC name is 8-(dimethylamino)-1-(4-methoxybutyl)-3-[(4-methoxyphenyl)methyl]-8-phenyl-1,3-diazaspiro[4.5]decan-2-one.
| Compound Name | 8-(dimethylamino)-1-(4-methoxybutyl)-3-[(4-methoxyphenyl)methyl]-8-phenyl-1,3-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 130202378 |
| Molecular Formula | C29H41N3O3 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.31 |
| IUPAC Name | 8-(dimethylamino)-1-(4-methoxybutyl)-3-[(4-methoxyphenyl)methyl]-8-phenyl-1,3-diazaspiro[4.5]decan-2-one |
| SMILES | COCCCCN1C(=O)N(Cc2ccc(OC)cc2)CC12CCC(c1ccccc1)(N(C)C)CC2 |
| InChI | InChI=1S/C29H41N3O3/c1-30(2)29(25-10-6-5-7-11-25)18-16-28(17-19-29)23-31(22-24-12-14-26(35-4)15-13-24)27(33)32(28)20-8-9-21-34-3/h5-7,10-15H,8-9,16-23H2,1-4H3 |
| InChIKey | KDLYBOULYFJNGG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|