About 3-methyl-2-(8-phenyl-1,3-diazaspiro[4.5]decan-3-yl)benzonitrile
3-methyl-2-(8-phenyl-1,3-diazaspiro[4.5]decan-3-yl)benzonitrile (PubChem CID 130202522) has the molecular formula C22H25N3
and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-methyl-2-(8-phenyl-1,3-diazaspiro[4.5]decan-3-yl)benzonitrile.
Molecular Properties
| Compound Name | 3-methyl-2-(8-phenyl-1,3-diazaspiro[4.5]decan-3-yl)benzonitrile |
| PubChem CID | 130202522 |
| Molecular Formula | C22H25N3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 3-methyl-2-(8-phenyl-1,3-diazaspiro[4.5]decan-3-yl)benzonitrile |
| SMILES | Cc1cccc(C#N)c1N1CNC2(CCC(c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C22H25N3/c1-17-6-5-9-20(14-23)21(17)25-15-22(24-16-25)12-10-19(11-13-22)18-7-3-2-4-8-18/h2-9,19,24H,10-13,15-16H2,1H3 |
| InChIKey | AUACTPXSUKLDFU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-2-(8-phenyl-1,3-diazaspiro[4.5]decan-3-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-(8-phenyl-1,3-diazaspiro[4.5]decan-3-yl)benzonitrile?
The IUPAC name of 3-methyl-2-(8-phenyl-1,3-diazaspiro[4.5]decan-3-yl)benzonitrile (CID 130202522) is 3-methyl-2-(8-phenyl-1,3-diazaspiro[4.5]decan-3-yl)benzonitrile.
What is the SMILES notation for 3-methyl-2-(8-phenyl-1,3-diazaspiro[4.5]decan-3-yl)benzonitrile?
The canonical SMILES for 3-methyl-2-(8-phenyl-1,3-diazaspiro[4.5]decan-3-yl)benzonitrile is Cc1cccc(C#N)c1N1CNC2(CCC(c3ccccc3)CC2)C1.
What is the InChIKey of 3-methyl-2-(8-phenyl-1,3-diazaspiro[4.5]decan-3-yl)benzonitrile?
The InChIKey is AUACTPXSUKLDFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3/c1-17-6-5-9-20(14-23)21(17)25-15-22(24-16-25)12-10-19(11-13-22)18-7-3-2-4-8-18/h2-9,19,24H,10-13,15-16H2,1H3.
What are the key properties of 3-methyl-2-(8-phenyl-1,3-diazaspiro[4.5]decan-3-yl)benzonitrile?
3-methyl-2-(8-phenyl-1,3-diazaspiro[4.5]decan-3-yl)benzonitrile has a molecular weight of 331.46 g/mol, XLogP of 4.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-(8-phenyl-1,3-diazaspiro[4.5]decan-3-yl)benzonitrile is sourced from PubChem (CID 130202522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).