C26H25ClN6O2 — CID 130203303
1-[3-[4-amino-3-(3-chloro-4-phenylmethoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 130203303) has the molecular formula C26H25ClN6O2 and a molecular weight of 488.98 g/mol. Its IUPAC name is 1-[3-[4-amino-3-(3-chloro-4-phenylmethoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-amino-3-(3-chloro-4-phenylmethoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 130203303 |
| Molecular Formula | C26H25ClN6O2 |
| Molecular Weight | 488.98 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 1-[3-[4-amino-3-(3-chloro-4-phenylmethoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(n2nc(-c3ccc(OCc4ccccc4)c(Cl)c3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C26H25ClN6O2/c1-2-22(34)32-12-6-9-19(14-32)33-26-23(25(28)29-16-30-26)24(31-33)18-10-11-21(20(27)13-18)35-15-17-7-4-3-5-8-17/h2-5,7-8,10-11,13,16,19H,1,6,9,12,14-15H2,(H2,28,29,30) |
| InChIKey | NPFWLQMYVZWBDU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.98 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|