C27H26ClFN6O2 — CID 130203348
N-[4-[4-amino-3-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]prop-2-enamide (PubChem CID 130203348) has the molecular formula C27H26ClFN6O2 and a molecular weight of 521.00 g/mol. Its IUPAC name is N-[4-[4-amino-3-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]prop-2-enamide.
| Compound Name | N-[4-[4-amino-3-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 130203348 |
| Molecular Formula | C27H26ClFN6O2 |
| Molecular Weight | 521.00 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | N-[4-[4-amino-3-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCC(n2nc(-c3ccc(OCc4cccc(F)c4)c(Cl)c3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C27H26ClFN6O2/c1-2-23(36)33-19-7-9-20(10-8-19)35-27-24(26(30)31-15-32-27)25(34-35)17-6-11-22(21(28)13-17)37-14-16-4-3-5-18(29)12-16/h2-6,11-13,15,19-20H,1,7-10,14H2,(H,33,36)(H2,30,31,32) |
| InChIKey | RRDMLLWHVPEZIO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.00 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|