C21H22F5NO2 — CID 130203622
1-[6-[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]phenyl]oxan-3-yl]propan-1-amine (PubChem CID 130203622) has the molecular formula C21H22F5NO2 and a molecular weight of 415.40 g/mol. Its IUPAC name is 1-[6-[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]phenyl]oxan-3-yl]propan-1-amine.
| Compound Name | 1-[6-[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]phenyl]oxan-3-yl]propan-1-amine |
|---|---|
| PubChem CID | 130203622 |
| Molecular Formula | C21H22F5NO2 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 1-[6-[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]phenyl]oxan-3-yl]propan-1-amine |
| SMILES | CCC(N)C1CCC(c2cc(F)c(OCc3cc(F)c(F)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C21H22F5NO2/c1-2-18(27)12-3-4-19(28-10-12)13-7-16(24)21(17(25)8-13)29-9-11-5-14(22)20(26)15(23)6-11/h5-8,12,18-19H,2-4,9-10,27H2,1H3 |
| InChIKey | JRUMMRFPRZZJFQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|