C15H23N7 — CID 130204072
2-[(2R,3E,5E)-4-amino-5-cyano-3-methylocta-3,5-dien-2-yl]-1-(2-methylpyrazol-3-yl)guanidine (PubChem CID 130204072) has the molecular formula C15H23N7 and a molecular weight of 301.40 g/mol. Its IUPAC name is 2-[(2R,3E,5E)-4-amino-5-cyano-3-methylocta-3,5-dien-2-yl]-1-(2-methylpyrazol-3-yl)guanidine.
| Compound Name | 2-[(2R,3E,5E)-4-amino-5-cyano-3-methylocta-3,5-dien-2-yl]-1-(2-methylpyrazol-3-yl)guanidine |
|---|---|
| PubChem CID | 130204072 |
| Molecular Formula | C15H23N7 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 2-[(2R,3E,5E)-4-amino-5-cyano-3-methylocta-3,5-dien-2-yl]-1-(2-methylpyrazol-3-yl)guanidine |
| SMILES | CC/C=C(C#N)\C(N)=C(\C)[C@@H](C)/N=C(\N)Nc1ccnn1C |
| InChI | InChI=1S/C15H23N7/c1-5-6-12(9-16)14(17)10(2)11(3)20-15(18)21-13-7-8-19-22(13)4/h6-8,11H,5,17H2,1-4H3,(H3,18,20,21)/b12-6-,14-10+/t11-/m1/s1 |
| InChIKey | RSVUGSVBKSMCFE-GPYPUFHESA-N |
| XLogP | 1.63 |
| TPSA | 118.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|