C25H16F5N7O — CID 130204124
5-[2-[(2-methylpyrazol-3-yl)amino]pyrimidin-4-yl]-1-[2-(2,3,4,5,6-pentafluorophenyl)acetyl]-2,3-dihydroindole-7-carbonitrile (PubChem CID 130204124) has the molecular formula C25H16F5N7O and a molecular weight of 525.44 g/mol. Its IUPAC name is 5-[2-[(2-methylpyrazol-3-yl)amino]pyrimidin-4-yl]-1-[2-(2,3,4,5,6-pentafluorophenyl)acetyl]-2,3-dihydroindole-7-carbonitrile.
| Compound Name | 5-[2-[(2-methylpyrazol-3-yl)amino]pyrimidin-4-yl]-1-[2-(2,3,4,5,6-pentafluorophenyl)acetyl]-2,3-dihydroindole-7-carbonitrile |
|---|---|
| PubChem CID | 130204124 |
| Molecular Formula | C25H16F5N7O |
| Molecular Weight | 525.44 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | 5-[2-[(2-methylpyrazol-3-yl)amino]pyrimidin-4-yl]-1-[2-(2,3,4,5,6-pentafluorophenyl)acetyl]-2,3-dihydroindole-7-carbonitrile |
| SMILES | Cn1nccc1Nc1nccc(-c2cc(C#N)c3c(c2)CCN3C(=O)Cc2c(F)c(F)c(F)c(F)c2F)n1 |
| InChI | InChI=1S/C25H16F5N7O/c1-36-17(3-6-33-36)35-25-32-5-2-16(34-25)13-8-12-4-7-37(24(12)14(9-13)11-31)18(38)10-15-19(26)21(28)23(30)22(29)20(15)27/h2-3,5-6,8-9H,4,7,10H2,1H3,(H,32,34,35) |
| InChIKey | INYUGJPGUGFCNM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 99.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|