About 4-fluoro-N,N,1-trimethylpyrrolidin-3-amine
4-fluoro-N,N,1-trimethylpyrrolidin-3-amine (PubChem CID 130204199) has the molecular formula C7H15FN2
and a molecular weight of 146.21 g/mol. Its IUPAC name is 4-fluoro-N,N,1-trimethylpyrrolidin-3-amine.
Molecular Properties
| Compound Name | 4-fluoro-N,N,1-trimethylpyrrolidin-3-amine |
| PubChem CID | 130204199 |
| Molecular Formula | C7H15FN2 |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.12 |
| IUPAC Name | 4-fluoro-N,N,1-trimethylpyrrolidin-3-amine |
| SMILES | CN1CC(F)C(N(C)C)C1 |
| InChI | InChI=1S/C7H15FN2/c1-9(2)7-5-10(3)4-6(7)8/h6-7H,4-5H2,1-3H3 |
| InChIKey | CIQYKDUFFQVDSF-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-N,N,1-trimethylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N,N,1-trimethylpyrrolidin-3-amine?
The IUPAC name of 4-fluoro-N,N,1-trimethylpyrrolidin-3-amine (CID 130204199) is 4-fluoro-N,N,1-trimethylpyrrolidin-3-amine.
What is the SMILES notation for 4-fluoro-N,N,1-trimethylpyrrolidin-3-amine?
The canonical SMILES for 4-fluoro-N,N,1-trimethylpyrrolidin-3-amine is CN1CC(F)C(N(C)C)C1.
What is the InChIKey of 4-fluoro-N,N,1-trimethylpyrrolidin-3-amine?
The InChIKey is CIQYKDUFFQVDSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15FN2/c1-9(2)7-5-10(3)4-6(7)8/h6-7H,4-5H2,1-3H3.
What are the key properties of 4-fluoro-N,N,1-trimethylpyrrolidin-3-amine?
4-fluoro-N,N,1-trimethylpyrrolidin-3-amine has a molecular weight of 146.21 g/mol, XLogP of 0.20, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N,N,1-trimethylpyrrolidin-3-amine is sourced from PubChem (CID 130204199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).