C23H20N4O6 — CID 130204568
methyl 4-[(6-ethyl-2,4-dimethyl-1,3,7,10-tetraoxopyrimido[4,5-c]isoquinolin-8-yl)amino]benzoate (PubChem CID 130204568) has the molecular formula C23H20N4O6 and a molecular weight of 448.44 g/mol. Its IUPAC name is methyl 4-[(6-ethyl-2,4-dimethyl-1,3,7,10-tetraoxopyrimido[4,5-c]isoquinolin-8-yl)amino]benzoate.
| Compound Name | methyl 4-[(6-ethyl-2,4-dimethyl-1,3,7,10-tetraoxopyrimido[4,5-c]isoquinolin-8-yl)amino]benzoate |
|---|---|
| PubChem CID | 130204568 |
| Molecular Formula | C23H20N4O6 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | methyl 4-[(6-ethyl-2,4-dimethyl-1,3,7,10-tetraoxopyrimido[4,5-c]isoquinolin-8-yl)amino]benzoate |
| SMILES | CCc1nc2c(c3c1C(=O)C(Nc1ccc(C(=O)OC)cc1)=CC3=O)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C23H20N4O6/c1-5-13-16-17(18-20(25-13)26(2)23(32)27(3)21(18)30)15(28)10-14(19(16)29)24-12-8-6-11(7-9-12)22(31)33-4/h6-10,24H,5H2,1-4H3 |
| InChIKey | LRNDKZXPUBRHBC-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|