About [(2S,3R,8S)-8-amino-2-methyl-9-oxooxonan-3-yl] cyclopentanecarboxylate
[(2S,3R,8S)-8-amino-2-methyl-9-oxooxonan-3-yl] cyclopentanecarboxylate (PubChem CID 130205012) has the molecular formula C15H25NO4
and a molecular weight of 283.37 g/mol. Its IUPAC name is [(2S,3R,8S)-8-amino-2-methyl-9-oxooxonan-3-yl] cyclopentanecarboxylate.
Molecular Properties
| Compound Name | [(2S,3R,8S)-8-amino-2-methyl-9-oxooxonan-3-yl] cyclopentanecarboxylate |
| PubChem CID | 130205012 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | [(2S,3R,8S)-8-amino-2-methyl-9-oxooxonan-3-yl] cyclopentanecarboxylate |
| SMILES | C[C@@H]1OC(=O)[C@@H](N)CCCC[C@H]1OC(=O)C1CCCC1 |
| InChI | InChI=1S/C15H25NO4/c1-10-13(20-14(17)11-6-2-3-7-11)9-5-4-8-12(16)15(18)19-10/h10-13H,2-9,16H2,1H3/t10-,12-,13+/m0/s1 |
| InChIKey | XRQCDCTVZLQPDR-WCFLWFBJSA-N |
| XLogP | 1.92 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2S,3R,8S)-8-amino-2-methyl-9-oxooxonan-3-yl] cyclopentanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R,8S)-8-amino-2-methyl-9-oxooxonan-3-yl] cyclopentanecarboxylate?
The IUPAC name of [(2S,3R,8S)-8-amino-2-methyl-9-oxooxonan-3-yl] cyclopentanecarboxylate (CID 130205012) is [(2S,3R,8S)-8-amino-2-methyl-9-oxooxonan-3-yl] cyclopentanecarboxylate.
What is the SMILES notation for [(2S,3R,8S)-8-amino-2-methyl-9-oxooxonan-3-yl] cyclopentanecarboxylate?
The canonical SMILES for [(2S,3R,8S)-8-amino-2-methyl-9-oxooxonan-3-yl] cyclopentanecarboxylate is C[C@@H]1OC(=O)[C@@H](N)CCCC[C@H]1OC(=O)C1CCCC1.
What is the InChIKey of [(2S,3R,8S)-8-amino-2-methyl-9-oxooxonan-3-yl] cyclopentanecarboxylate?
The InChIKey is XRQCDCTVZLQPDR-WCFLWFBJSA-N. The full InChI is InChI=1S/C15H25NO4/c1-10-13(20-14(17)11-6-2-3-7-11)9-5-4-8-12(16)15(18)19-10/h10-13H,2-9,16H2,1H3/t10-,12-,13+/m0/s1.
What are the key properties of [(2S,3R,8S)-8-amino-2-methyl-9-oxooxonan-3-yl] cyclopentanecarboxylate?
[(2S,3R,8S)-8-amino-2-methyl-9-oxooxonan-3-yl] cyclopentanecarboxylate has a molecular weight of 283.37 g/mol, XLogP of 1.92, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R,8S)-8-amino-2-methyl-9-oxooxonan-3-yl] cyclopentanecarboxylate is sourced from PubChem (CID 130205012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).