About 2-ethoxy-3-propan-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole
2-ethoxy-3-propan-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole (PubChem CID 130205037) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-ethoxy-3-propan-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole.
Molecular Properties
| Compound Name | 2-ethoxy-3-propan-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole |
| PubChem CID | 130205037 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-ethoxy-3-propan-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole |
| SMILES | CCOc1nn2c(c1C(C)C)CCC2 |
| InChI | InChI=1S/C11H18N2O/c1-4-14-11-10(8(2)3)9-6-5-7-13(9)12-11/h8H,4-7H2,1-3H3 |
| InChIKey | XVYBXBGAFSMCDT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethoxy-3-propan-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-3-propan-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole?
The IUPAC name of 2-ethoxy-3-propan-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole (CID 130205037) is 2-ethoxy-3-propan-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole.
What is the SMILES notation for 2-ethoxy-3-propan-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole?
The canonical SMILES for 2-ethoxy-3-propan-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole is CCOc1nn2c(c1C(C)C)CCC2.
What is the InChIKey of 2-ethoxy-3-propan-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole?
The InChIKey is XVYBXBGAFSMCDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O/c1-4-14-11-10(8(2)3)9-6-5-7-13(9)12-11/h8H,4-7H2,1-3H3.
What are the key properties of 2-ethoxy-3-propan-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole?
2-ethoxy-3-propan-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole has a molecular weight of 194.28 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-3-propan-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole is sourced from PubChem (CID 130205037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).