C24H29N3O3S — CID 130205062
N-hydroxy-1-[4-[2-(2-methoxyethyl)-3,4-dihydro-1H-isoquinolin-7-yl]phenyl]sulfanyl-3,6-dihydro-2H-pyridine-4-carboxamide (PubChem CID 130205062) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is N-hydroxy-1-[4-[2-(2-methoxyethyl)-3,4-dihydro-1H-isoquinolin-7-yl]phenyl]sulfanyl-3,6-dihydro-2H-pyridine-4-carboxamide.
| Compound Name | N-hydroxy-1-[4-[2-(2-methoxyethyl)-3,4-dihydro-1H-isoquinolin-7-yl]phenyl]sulfanyl-3,6-dihydro-2H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 130205062 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-hydroxy-1-[4-[2-(2-methoxyethyl)-3,4-dihydro-1H-isoquinolin-7-yl]phenyl]sulfanyl-3,6-dihydro-2H-pyridine-4-carboxamide |
| SMILES | COCCN1CCc2ccc(-c3ccc(SN4CC=C(C(=O)NO)CC4)cc3)cc2C1 |
| InChI | InChI=1S/C24H29N3O3S/c1-30-15-14-26-11-8-19-2-3-21(16-22(19)17-26)18-4-6-23(7-5-18)31-27-12-9-20(10-13-27)24(28)25-29/h2-7,9,16,29H,8,10-15,17H2,1H3,(H,25,28) |
| InChIKey | XIWNBYOAISIQIN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|