About N-hydroxy-1-methyl-3,6-dihydro-2H-pyridine-4-carboxamide
N-hydroxy-1-methyl-3,6-dihydro-2H-pyridine-4-carboxamide (PubChem CID 130205235) has the molecular formula C7H12N2O2
and a molecular weight of 156.19 g/mol. Its IUPAC name is N-hydroxy-1-methyl-3,6-dihydro-2H-pyridine-4-carboxamide.
Molecular Properties
| Compound Name | N-hydroxy-1-methyl-3,6-dihydro-2H-pyridine-4-carboxamide |
| PubChem CID | 130205235 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | N-hydroxy-1-methyl-3,6-dihydro-2H-pyridine-4-carboxamide |
| SMILES | CN1CC=C(C(=O)NO)CC1 |
| InChI | InChI=1S/C7H12N2O2/c1-9-4-2-6(3-5-9)7(10)8-11/h2,11H,3-5H2,1H3,(H,8,10) |
| InChIKey | JMYNAJGJUSKVPA-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-1-methyl-3,6-dihydro-2H-pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-1-methyl-3,6-dihydro-2H-pyridine-4-carboxamide?
The IUPAC name of N-hydroxy-1-methyl-3,6-dihydro-2H-pyridine-4-carboxamide (CID 130205235) is N-hydroxy-1-methyl-3,6-dihydro-2H-pyridine-4-carboxamide.
What is the SMILES notation for N-hydroxy-1-methyl-3,6-dihydro-2H-pyridine-4-carboxamide?
The canonical SMILES for N-hydroxy-1-methyl-3,6-dihydro-2H-pyridine-4-carboxamide is CN1CC=C(C(=O)NO)CC1.
What is the InChIKey of N-hydroxy-1-methyl-3,6-dihydro-2H-pyridine-4-carboxamide?
The InChIKey is JMYNAJGJUSKVPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2/c1-9-4-2-6(3-5-9)7(10)8-11/h2,11H,3-5H2,1H3,(H,8,10).
What are the key properties of N-hydroxy-1-methyl-3,6-dihydro-2H-pyridine-4-carboxamide?
N-hydroxy-1-methyl-3,6-dihydro-2H-pyridine-4-carboxamide has a molecular weight of 156.19 g/mol, XLogP of -0.25, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-1-methyl-3,6-dihydro-2H-pyridine-4-carboxamide is sourced from PubChem (CID 130205235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).