C15H31N — CID 130205278
N,4,4,6,6-pentamethyl-N-[(Z)-prop-1-enyl]heptan-2-amine (PubChem CID 130205278) has the molecular formula C15H31N and a molecular weight of 225.42 g/mol. Its IUPAC name is N,4,4,6,6-pentamethyl-N-[(Z)-prop-1-enyl]heptan-2-amine.
| Compound Name | N,4,4,6,6-pentamethyl-N-[(Z)-prop-1-enyl]heptan-2-amine |
|---|---|
| PubChem CID | 130205278 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | N,4,4,6,6-pentamethyl-N-[(Z)-prop-1-enyl]heptan-2-amine |
| SMILES | C/C=C\N(C)C(C)CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C15H31N/c1-9-10-16(8)13(2)11-15(6,7)12-14(3,4)5/h9-10,13H,11-12H2,1-8H3/b10-9- |
| InChIKey | QGJZJJNBKGDERK-KTKRTIGZSA-N |
| XLogP | 4.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |