About 3-methoxy-2-methyl-2,5-dihydrothiophene
3-methoxy-2-methyl-2,5-dihydrothiophene (PubChem CID 130205381) has the molecular formula C6H10OS
and a molecular weight of 130.21 g/mol. Its IUPAC name is 3-methoxy-2-methyl-2,5-dihydrothiophene.
Molecular Properties
| Compound Name | 3-methoxy-2-methyl-2,5-dihydrothiophene |
| PubChem CID | 130205381 |
| Molecular Formula | C6H10OS |
| Molecular Weight | 130.21 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | 3-methoxy-2-methyl-2,5-dihydrothiophene |
| SMILES | COC1=CCSC1C |
| InChI | InChI=1S/C6H10OS/c1-5-6(7-2)3-4-8-5/h3,5H,4H2,1-2H3 |
| InChIKey | DZAGQHJPNXHKDF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.21 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxy-2-methyl-2,5-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2-methyl-2,5-dihydrothiophene?
The IUPAC name of 3-methoxy-2-methyl-2,5-dihydrothiophene (CID 130205381) is 3-methoxy-2-methyl-2,5-dihydrothiophene.
What is the SMILES notation for 3-methoxy-2-methyl-2,5-dihydrothiophene?
The canonical SMILES for 3-methoxy-2-methyl-2,5-dihydrothiophene is COC1=CCSC1C.
What is the InChIKey of 3-methoxy-2-methyl-2,5-dihydrothiophene?
The InChIKey is DZAGQHJPNXHKDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10OS/c1-5-6(7-2)3-4-8-5/h3,5H,4H2,1-2H3.
What are the key properties of 3-methoxy-2-methyl-2,5-dihydrothiophene?
3-methoxy-2-methyl-2,5-dihydrothiophene has a molecular weight of 130.21 g/mol, XLogP of 1.65, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2-methyl-2,5-dihydrothiophene is sourced from PubChem (CID 130205381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).