C12H18N6O6 — CID 130205682
1-azido-3-[[(2S,3R,4S)-3-azido-4-hydroxy-6-(hydroxymethyl)-3,4-dihydro-2H-pyran-2-yl]oxy]cyclohexane-1,2-diol (PubChem CID 130205682) has the molecular formula C12H18N6O6 and a molecular weight of 342.31 g/mol. Its IUPAC name is 1-azido-3-[[(2S,3R,4S)-3-azido-4-hydroxy-6-(hydroxymethyl)-3,4-dihydro-2H-pyran-2-yl]oxy]cyclohexane-1,2-diol.
| Compound Name | 1-azido-3-[[(2S,3R,4S)-3-azido-4-hydroxy-6-(hydroxymethyl)-3,4-dihydro-2H-pyran-2-yl]oxy]cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 130205682 |
| Molecular Formula | C12H18N6O6 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 1-azido-3-[[(2S,3R,4S)-3-azido-4-hydroxy-6-(hydroxymethyl)-3,4-dihydro-2H-pyran-2-yl]oxy]cyclohexane-1,2-diol |
| SMILES | [N-]=[N+]=N[C@H]1[C@@H](OC2CCCC(O)(N=[N+]=[N-])C2O)OC(CO)=C[C@@H]1O |
| InChI | InChI=1S/C12H18N6O6/c13-17-15-9-7(20)4-6(5-19)23-11(9)24-8-2-1-3-12(22,10(8)21)16-18-14/h4,7-11,19-22H,1-3,5H2/t7-,8?,9+,10?,11+,12?/m0/s1 |
| InChIKey | PWPFDSVGEVGCKO-DOQUQWIASA-N |
| XLogP | 0.19 |
| TPSA | 196.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|